Chemical Compounds Structural Formulas Explained
Can you draw the condensed or line-angle structural formula for the following chemical compounds?
a. ethyl propyl ether
b. cyclopropyl ethyl ether
c. methoxycyclopentane
d. 1-ethoxy-2-methylbutane
Answer:
The structures of the given chemical compounds can be drawn by arranging the indicated molecular fragments around an oxygen atom. Each compound's structure is unique, reflecting its specific combination of molecular fragments.
The process of drawing the structures includes identifying and arranging the indicated molecular fragments:
a. Ethyl propyl ether: Ethyl (CH3-CH2-) and propyl (CH3-CH2-CH2-) fragments, bound by an oxygen atom, would be drawn as: CH3-CH2-O-CH2-CH2-CH3. b. Cyclopropyl ethyl ether: Cyclopropyl is a three-carbon ring and ethyl is a two-carbon fragment. The structure would be drawn as: C3H5-O-CH2-CH3. c. Methoxycyclopentane: Methoxy (CH3-O-) fragment and cyclopentane, a five-carbon ring. The structure is: cyclo-C5H9-O-CH3. d. 1-ethoxy-2-methylbutane: This is a butane chain (four carbons) with an ethoxy group (CH3-CH2-O-) on the first carbon and a methyl group (CH3) on the second carbon. The structure would be: CH3-CH2-O-CH(CH3)-CH2-CH3.